C18H20N4O4 — CID 67584394
3-[3-amino-4-[3-(hydrazinylmethylideneamino)benzoyl]-2-methoxyphenyl]propanoic acid (PubChem CID 67584394) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-[3-amino-4-[3-(hydrazinylmethylideneamino)benzoyl]-2-methoxyphenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[3-(hydrazinylmethylideneamino)benzoyl]-2-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 67584394 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 3-[3-amino-4-[3-(hydrazinylmethylideneamino)benzoyl]-2-methoxyphenyl]propanoic acid |
| SMILES | COc1c(CCC(=O)O)ccc(C(=O)c2cccc(/N=C/NN)c2)c1N |
| InChI | InChI=1S/C18H20N4O4/c1-26-18-11(6-8-15(23)24)5-7-14(16(18)19)17(25)12-3-2-4-13(9-12)21-10-22-20/h2-5,7,9-10H,6,8,19-20H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | LBQJARRGGPFDOK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|