C21H24N4O4 — CID 19076737
ethyl 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]-2-methoxyphenyl]cyclopropane-1-carboxylate (PubChem CID 19076737) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is ethyl 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]-2-methoxyphenyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]-2-methoxyphenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 19076737 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | ethyl 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]-2-methoxyphenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1c1ccc(NC(=O)c2cccc(/N=C/NN)c2)cc1OC |
| InChI | InChI=1S/C21H24N4O4/c1-3-29-21(27)18-11-17(18)16-8-7-15(10-19(16)28-2)25-20(26)13-5-4-6-14(9-13)23-12-24-22/h4-10,12,17-18H,3,11,22H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | YRXPIHYBMIFKRP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|