C15H14N4O3 — CID 152729082
3-azido-N-(3,4-dimethoxyphenyl)benzamide (PubChem CID 152729082) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is 3-azido-N-(3,4-dimethoxyphenyl)benzamide.
| Compound Name | 3-azido-N-(3,4-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 152729082 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-azido-N-(3,4-dimethoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(N=[N+]=[N-])c2)cc1OC |
| InChI | InChI=1S/C15H14N4O3/c1-21-13-7-6-11(9-14(13)22-2)17-15(20)10-4-3-5-12(8-10)18-19-16/h3-9H,1-2H3,(H,17,20) |
| InChIKey | ZXFQZJGEPKRGGN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|