C16H7Br2F6N5O — CID 42630657
N-[2,4-dibromo-6-(2H-tetrazol-5-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 42630657) has the molecular formula C16H7Br2F6N5O and a molecular weight of 559.06 g/mol. Its IUPAC name is N-[2,4-dibromo-6-(2H-tetrazol-5-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2,4-dibromo-6-(2H-tetrazol-5-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42630657 |
| Molecular Formula | C16H7Br2F6N5O |
| Molecular Weight | 559.06 g/mol |
| Exact Mass | 556.89 |
| IUPAC Name | N-[2,4-dibromo-6-(2H-tetrazol-5-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1c(Br)cc(Br)cc1-c1nn[nH]n1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H7Br2F6N5O/c17-9-4-10(13-26-28-29-27-13)12(11(18)5-9)25-14(30)6-1-7(15(19,20)21)3-8(2-6)16(22,23)24/h1-5H,(H,25,30)(H,26,27,28,29) |
| InChIKey | OAEOJNRHAYQMQW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.06 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |