C13H7F6N3O3 — CID 3526595
N-(2,4-dioxo-1H-pyrimidin-6-yl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 3526595) has the molecular formula C13H7F6N3O3 and a molecular weight of 367.21 g/mol. Its IUPAC name is N-(2,4-dioxo-1H-pyrimidin-6-yl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(2,4-dioxo-1H-pyrimidin-6-yl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3526595 |
| Molecular Formula | C13H7F6N3O3 |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | N-(2,4-dioxo-1H-pyrimidin-6-yl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cc(=O)[nH]c(=O)[nH]1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7F6N3O3/c14-12(15,16)6-1-5(2-7(3-6)13(17,18)19)10(24)20-8-4-9(23)22-11(25)21-8/h1-4H,(H3,20,21,22,23,24,25) |
| InChIKey | UGZFIUDZBKIRBI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |