C16H9BrF6N6O — CID 87958845
1-[3,5-bis(trifluoromethyl)phenyl]-1-[2-bromo-4-(2H-tetrazol-5-yl)phenyl]urea (PubChem CID 87958845) has the molecular formula C16H9BrF6N6O and a molecular weight of 495.18 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-1-[2-bromo-4-(2H-tetrazol-5-yl)phenyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-1-[2-bromo-4-(2H-tetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 87958845 |
| Molecular Formula | C16H9BrF6N6O |
| Molecular Weight | 495.18 g/mol |
| Exact Mass | 493.99 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-1-[2-bromo-4-(2H-tetrazol-5-yl)phenyl]urea |
| SMILES | NC(=O)N(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(-c2nn[nH]n2)cc1Br |
| InChI | InChI=1S/C16H9BrF6N6O/c17-11-3-7(13-25-27-28-26-13)1-2-12(11)29(14(24)30)10-5-8(15(18,19)20)4-9(6-10)16(21,22)23/h1-6H,(H2,24,30)(H,25,26,27,28) |
| InChIKey | BVRKJJFWQOXRMW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.18 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |