C21H20BrClF3N5O7 — CID 162319975
3-(3-bromo-5-chloro-2-hydroxyphenyl)-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 162319975) has the molecular formula C21H20BrClF3N5O7 and a molecular weight of 626.77 g/mol. Its IUPAC name is 3-(3-bromo-5-chloro-2-hydroxyphenyl)-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(3-bromo-5-chloro-2-hydroxyphenyl)-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162319975 |
| Molecular Formula | C21H20BrClF3N5O7 |
| Molecular Weight | 626.77 g/mol |
| Exact Mass | 625.02 |
| IUPAC Name | 3-(3-bromo-5-chloro-2-hydroxyphenyl)-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NN/C=N/c1cccc(C(=O)NCC(=O)NC(CC(=O)O)c2cc(Cl)cc(Br)c2O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H19BrClN5O5.C2HF3O2/c20-14-6-11(21)5-13(18(14)30)15(7-17(28)29)26-16(27)8-23-19(31)10-2-1-3-12(4-10)24-9-25-22;3-2(4,5)1(6)7/h1-6,9,15,30H,7-8,22H2,(H,23,31)(H,24,25)(H,26,27)(H,28,29);(H,6,7) |
| InChIKey | PNQJDOYPOKLGIY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.77 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|