C17H26N6O4 — CID 19063163
ethyl 2-[[2-[4-(hydrazinylmethylideneamino)butanoylamino]acetyl]amino]-3-pyridin-3-ylpropanoate (PubChem CID 19063163) has the molecular formula C17H26N6O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(hydrazinylmethylideneamino)butanoylamino]acetyl]amino]-3-pyridin-3-ylpropanoate.
| Compound Name | ethyl 2-[[2-[4-(hydrazinylmethylideneamino)butanoylamino]acetyl]amino]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 19063163 |
| Molecular Formula | C17H26N6O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | ethyl 2-[[2-[4-(hydrazinylmethylideneamino)butanoylamino]acetyl]amino]-3-pyridin-3-ylpropanoate |
| SMILES | CCOC(=O)C(Cc1cccnc1)NC(=O)CNC(=O)CCC/N=C/NN |
| InChI | InChI=1S/C17H26N6O4/c1-2-27-17(26)14(9-13-5-3-7-19-10-13)23-16(25)11-21-15(24)6-4-8-20-12-22-18/h3,5,7,10,12,14H,2,4,6,8-9,11,18H2,1H3,(H,20,22)(H,21,24)(H,23,25) |
| InChIKey | VBINPUDNGPYLLS-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|