C21H26N6O4 — CID 19063161
3-[[2-[[4-(hydrazinylmethylideneamino)-3-phenylbutanoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 19063161) has the molecular formula C21H26N6O4 and a molecular weight of 426.48 g/mol. Its IUPAC name is 3-[[2-[[4-(hydrazinylmethylideneamino)-3-phenylbutanoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[2-[[4-(hydrazinylmethylideneamino)-3-phenylbutanoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 19063161 |
| Molecular Formula | C21H26N6O4 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 3-[[2-[[4-(hydrazinylmethylideneamino)-3-phenylbutanoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | NN/C=N/CC(CC(=O)NCC(=O)NC(CC(=O)O)c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C21H26N6O4/c22-26-14-24-12-17(15-5-2-1-3-6-15)9-19(28)25-13-20(29)27-18(10-21(30)31)16-7-4-8-23-11-16/h1-8,11,14,17-18H,9-10,12-13,22H2,(H,24,26)(H,25,28)(H,27,29)(H,30,31) |
| InChIKey | CNPZWQABSVQJBI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|