C23H30N6O4 — CID 19063158
ethyl 2-[[2-[[4-(hydrazinylmethylideneamino)-3-phenylbutanoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoate (PubChem CID 19063158) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is ethyl 2-[[2-[[4-(hydrazinylmethylideneamino)-3-phenylbutanoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoate.
| Compound Name | ethyl 2-[[2-[[4-(hydrazinylmethylideneamino)-3-phenylbutanoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 19063158 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | ethyl 2-[[2-[[4-(hydrazinylmethylideneamino)-3-phenylbutanoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoate |
| SMILES | CCOC(=O)C(Cc1cccnc1)NC(=O)CNC(=O)CC(C/N=C/NN)c1ccccc1 |
| InChI | InChI=1S/C23H30N6O4/c1-2-33-23(32)20(11-17-7-6-10-25-13-17)29-22(31)15-27-21(30)12-19(14-26-16-28-24)18-8-4-3-5-9-18/h3-10,13,16,19-20H,2,11-12,14-15,24H2,1H3,(H,26,28)(H,27,30)(H,29,31) |
| InChIKey | QKGQXRLARSJSCD-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|