C22H23N3O3S — CID 20667034
3-amino-N-[4-[2-(benzenesulfonamido)propyl]phenyl]benzamide (PubChem CID 20667034) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-amino-N-[4-[2-(benzenesulfonamido)propyl]phenyl]benzamide.
| Compound Name | 3-amino-N-[4-[2-(benzenesulfonamido)propyl]phenyl]benzamide |
|---|---|
| PubChem CID | 20667034 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-amino-N-[4-[2-(benzenesulfonamido)propyl]phenyl]benzamide |
| SMILES | CC(Cc1ccc(NC(=O)c2cccc(N)c2)cc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-16(25-29(27,28)21-8-3-2-4-9-21)14-17-10-12-20(13-11-17)24-22(26)18-6-5-7-19(23)15-18/h2-13,15-16,25H,14,23H2,1H3,(H,24,26) |
| InChIKey | GHBPJSZSXUSRDO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|