C26H33N5O6 — CID 153217455
(3S)-6-[[3-(diaminomethylideneamino)benzoyl]amino]-3-[[4-(3-methylbutoxy)phenyl]carbamoyl]-5-oxohexanoic acid (PubChem CID 153217455) has the molecular formula C26H33N5O6 and a molecular weight of 511.58 g/mol. Its IUPAC name is (3S)-6-[[3-(diaminomethylideneamino)benzoyl]amino]-3-[[4-(3-methylbutoxy)phenyl]carbamoyl]-5-oxohexanoic acid.
| Compound Name | (3S)-6-[[3-(diaminomethylideneamino)benzoyl]amino]-3-[[4-(3-methylbutoxy)phenyl]carbamoyl]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 153217455 |
| Molecular Formula | C26H33N5O6 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (3S)-6-[[3-(diaminomethylideneamino)benzoyl]amino]-3-[[4-(3-methylbutoxy)phenyl]carbamoyl]-5-oxohexanoic acid |
| SMILES | CC(C)CCOc1ccc(NC(=O)[C@H](CC(=O)O)CC(=O)CNC(=O)c2cccc(N=C(N)N)c2)cc1 |
| InChI | InChI=1S/C26H33N5O6/c1-16(2)10-11-37-22-8-6-19(7-9-22)30-25(36)18(14-23(33)34)13-21(32)15-29-24(35)17-4-3-5-20(12-17)31-26(27)28/h3-9,12,16,18H,10-11,13-15H2,1-2H3,(H,29,35)(H,30,36)(H,33,34)(H4,27,28,31)/t18-/m0/s1 |
| InChIKey | WMZLSTLYLMANON-SFHVURJKSA-N |
| XLogP | 2.43 |
| TPSA | 186.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|