C19H17BrClN5O4 — CID 20745537
N-[2-[(6-bromo-8-chloro-2-oxo-3,4-dihydrochromen-4-yl)amino]-2-oxoethyl]-3-(diaminomethylideneamino)benzamide (PubChem CID 20745537) has the molecular formula C19H17BrClN5O4 and a molecular weight of 494.73 g/mol. Its IUPAC name is N-[2-[(6-bromo-8-chloro-2-oxo-3,4-dihydrochromen-4-yl)amino]-2-oxoethyl]-3-(diaminomethylideneamino)benzamide.
| Compound Name | N-[2-[(6-bromo-8-chloro-2-oxo-3,4-dihydrochromen-4-yl)amino]-2-oxoethyl]-3-(diaminomethylideneamino)benzamide |
|---|---|
| PubChem CID | 20745537 |
| Molecular Formula | C19H17BrClN5O4 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | N-[2-[(6-bromo-8-chloro-2-oxo-3,4-dihydrochromen-4-yl)amino]-2-oxoethyl]-3-(diaminomethylideneamino)benzamide |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)NC2CC(=O)Oc3c(Cl)cc(Br)cc32)c1 |
| InChI | InChI=1S/C19H17BrClN5O4/c20-10-5-12-14(7-16(28)30-17(12)13(21)6-10)26-15(27)8-24-18(29)9-2-1-3-11(4-9)25-19(22)23/h1-6,14H,7-8H2,(H,24,29)(H,26,27)(H4,22,23,25) |
| InChIKey | VWRJECVBHYBIJM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|