C12H13F4NO — CID 107290953
1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-2-(methylamino)propan-1-one (PubChem CID 107290953) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-2-(methylamino)propan-1-one.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-2-(methylamino)propan-1-one |
|---|---|
| PubChem CID | 107290953 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-2-(methylamino)propan-1-one |
| SMILES | CNC(C)(C)C(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F4NO/c1-11(2,17-3)10(18)7-4-5-9(13)8(6-7)12(14,15)16/h4-6,17H,1-3H3 |
| InChIKey | DCNBFDRCLIUNQI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |