C17H17N3O3S3 — CID 134061805
4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]thiophene-2-sulfonamide (PubChem CID 134061805) has the molecular formula C17H17N3O3S3 and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]thiophene-2-sulfonamide.
| Compound Name | 4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 134061805 |
| Molecular Formula | C17H17N3O3S3 |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)N2CCC(c3nc4ccccc4s3)CC2)cs1 |
| InChI | InChI=1S/C17H17N3O3S3/c18-26(22,23)15-9-12(10-24-15)17(21)20-7-5-11(6-8-20)16-19-13-3-1-2-4-14(13)25-16/h1-4,9-11H,5-8H2,(H2,18,22,23) |
| InChIKey | SBCDSEXZJVMMEO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |