C18H21N3O4S2 — CID 90480647
1-[2-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]sulfonylethyl]pyrrolidine-2,5-dione (PubChem CID 90480647) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-[2-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]sulfonylethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]sulfonylethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 90480647 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 1-[2-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]sulfonylethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCS(=O)(=O)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C18H21N3O4S2/c22-16-5-6-17(23)21(16)11-12-27(24,25)20-9-7-13(8-10-20)18-19-14-3-1-2-4-15(14)26-18/h1-4,13H,5-12H2 |
| InChIKey | XDBYVXUCKHVMLG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|