C21H23N2O2S+ — CID 9337126
methyl 3-[[4-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]benzoate (PubChem CID 9337126) has the molecular formula C21H23N2O2S+ and a molecular weight of 367.49 g/mol. Its IUPAC name is methyl 3-[[4-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[4-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 9337126 |
| Molecular Formula | C21H23N2O2S+ |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | methyl 3-[[4-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(C[NH+]2CCC(c3nc4ccccc4s3)CC2)c1 |
| InChI | InChI=1S/C21H22N2O2S/c1-25-21(24)17-6-4-5-15(13-17)14-23-11-9-16(10-12-23)20-22-18-7-2-3-8-19(18)26-20/h2-8,13,16H,9-12,14H2,1H3/p+1 |
| InChIKey | DYQLXULFPMPQFU-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |