C20H23N2OS+ — CID 9388227
2-[(3R)-1-[(3-methoxyphenyl)methyl]piperidin-1-ium-3-yl]-1,3-benzothiazole (PubChem CID 9388227) has the molecular formula C20H23N2OS+ and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[(3R)-1-[(3-methoxyphenyl)methyl]piperidin-1-ium-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[(3R)-1-[(3-methoxyphenyl)methyl]piperidin-1-ium-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 9388227 |
| Molecular Formula | C20H23N2OS+ |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[(3R)-1-[(3-methoxyphenyl)methyl]piperidin-1-ium-3-yl]-1,3-benzothiazole |
| SMILES | COc1cccc(C[NH+]2CCC[C@@H](c3nc4ccccc4s3)C2)c1 |
| InChI | InChI=1S/C20H22N2OS/c1-23-17-8-4-6-15(12-17)13-22-11-5-7-16(14-22)20-21-18-9-2-3-10-19(18)24-20/h2-4,6,8-10,12,16H,5,7,11,13-14H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | ULOPXHZVTYNQGF-MRXNPFEDSA-O |
| XLogP | 3.27 |
| TPSA | 26.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |