C21H26N3O2+ — CID 7184333
2-[(3S)-1-[(3,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-yl]-1H-benzimidazole (PubChem CID 7184333) has the molecular formula C21H26N3O2+ and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[(3S)-1-[(3,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-yl]-1H-benzimidazole.
| Compound Name | 2-[(3S)-1-[(3,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 7184333 |
| Molecular Formula | C21H26N3O2+ |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-[(3S)-1-[(3,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-yl]-1H-benzimidazole |
| SMILES | COc1cc(C[NH+]2CCC[C@H](c3nc4ccccc4[nH]3)C2)cc(OC)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-25-17-10-15(11-18(12-17)26-2)13-24-9-5-6-16(14-24)21-22-19-7-3-4-8-20(19)23-21/h3-4,7-8,10-12,16H,5-6,9,13-14H2,1-2H3,(H,22,23)/p+1/t16-/m0/s1 |
| InChIKey | FSORWBBNZGXVQW-INIZCTEOSA-O |
| XLogP | 2.54 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |