C13H20NO2+ — CID 7439248
(3R)-1-[(4-methoxyphenyl)methyl]piperidin-1-ium-3-ol (PubChem CID 7439248) has the molecular formula C13H20NO2+ and a molecular weight of 222.31 g/mol. Its IUPAC name is (3R)-1-[(4-methoxyphenyl)methyl]piperidin-1-ium-3-ol.
| Compound Name | (3R)-1-[(4-methoxyphenyl)methyl]piperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 7439248 |
| Molecular Formula | C13H20NO2+ |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (3R)-1-[(4-methoxyphenyl)methyl]piperidin-1-ium-3-ol |
| SMILES | COc1ccc(C[NH+]2CCC[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C13H19NO2/c1-16-13-6-4-11(5-7-13)9-14-8-2-3-12(15)10-14/h4-7,12,15H,2-3,8-10H2,1H3/p+1/t12-/m1/s1 |
| InChIKey | BHSIHYZSNGOYDV-GFCCVEGCSA-O |
| XLogP | 0.23 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |