C14H22NO3+ — CID 2173552
(3S)-1-[(2,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-ol (PubChem CID 2173552) has the molecular formula C14H22NO3+ and a molecular weight of 252.33 g/mol. Its IUPAC name is (3S)-1-[(2,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-ol.
| Compound Name | (3S)-1-[(2,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 2173552 |
| Molecular Formula | C14H22NO3+ |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (3S)-1-[(2,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-ol |
| SMILES | COc1ccc(OC)c(C[NH+]2CCC[C@H](O)C2)c1 |
| InChI | InChI=1S/C14H21NO3/c1-17-13-5-6-14(18-2)11(8-13)9-15-7-3-4-12(16)10-15/h5-6,8,12,16H,3-4,7,9-10H2,1-2H3/p+1/t12-/m0/s1 |
| InChIKey | JAITZLCJEAIXBU-LBPRGKRZSA-O |
| XLogP | 0.24 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |