C14H21BrNO3+ — CID 7442851
(3R)-1-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-ol (PubChem CID 7442851) has the molecular formula C14H21BrNO3+ and a molecular weight of 331.23 g/mol. Its IUPAC name is (3R)-1-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-ol.
| Compound Name | (3R)-1-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 7442851 |
| Molecular Formula | C14H21BrNO3+ |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (3R)-1-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperidin-1-ium-3-ol |
| SMILES | COc1cc(Br)c(C[NH+]2CCC[C@@H](O)C2)cc1OC |
| InChI | InChI=1S/C14H20BrNO3/c1-18-13-6-10(12(15)7-14(13)19-2)8-16-5-3-4-11(17)9-16/h6-7,11,17H,3-5,8-9H2,1-2H3/p+1/t11-/m1/s1 |
| InChIKey | QZXNGGWIMMZYMH-LLVKDONJSA-O |
| XLogP | 1.01 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |