C15H24NO4+ — CID 6939511
1-[(2,4,5-trimethoxyphenyl)methyl]piperidin-1-ium-4-ol (PubChem CID 6939511) has the molecular formula C15H24NO4+ and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-[(2,4,5-trimethoxyphenyl)methyl]piperidin-1-ium-4-ol.
| Compound Name | 1-[(2,4,5-trimethoxyphenyl)methyl]piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 6939511 |
| Molecular Formula | C15H24NO4+ |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-[(2,4,5-trimethoxyphenyl)methyl]piperidin-1-ium-4-ol |
| SMILES | COc1cc(OC)c(OC)cc1C[NH+]1CCC(O)CC1 |
| InChI | InChI=1S/C15H23NO4/c1-18-13-9-15(20-3)14(19-2)8-11(13)10-16-6-4-12(17)5-7-16/h8-9,12,17H,4-7,10H2,1-3H3/p+1 |
| InChIKey | SAOFPHXMEXZHSU-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 52.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |