C14H21BrNO+ — CID 6943194
(3S)-1-[(5-bromo-2-methoxyphenyl)methyl]-3-methylpiperidin-1-ium (PubChem CID 6943194) has the molecular formula C14H21BrNO+ and a molecular weight of 299.23 g/mol. Its IUPAC name is (3S)-1-[(5-bromo-2-methoxyphenyl)methyl]-3-methylpiperidin-1-ium.
| Compound Name | (3S)-1-[(5-bromo-2-methoxyphenyl)methyl]-3-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 6943194 |
| Molecular Formula | C14H21BrNO+ |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (3S)-1-[(5-bromo-2-methoxyphenyl)methyl]-3-methylpiperidin-1-ium |
| SMILES | COc1ccc(Br)cc1C[NH+]1CCC[C@H](C)C1 |
| InChI | InChI=1S/C14H20BrNO/c1-11-4-3-7-16(9-11)10-12-8-13(15)5-6-14(12)17-2/h5-6,8,11H,3-4,7,9-10H2,1-2H3/p+1/t11-/m0/s1 |
| InChIKey | CSEIZIUAIKPHGU-NSHDSACASA-O |
| XLogP | 2.27 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |