C12H16F2NO+ — CID 6938397
(3S)-1-[(2,5-difluorophenyl)methyl]piperidin-1-ium-3-ol (PubChem CID 6938397) has the molecular formula C12H16F2NO+ and a molecular weight of 228.26 g/mol. Its IUPAC name is (3S)-1-[(2,5-difluorophenyl)methyl]piperidin-1-ium-3-ol.
| Compound Name | (3S)-1-[(2,5-difluorophenyl)methyl]piperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 6938397 |
| Molecular Formula | C12H16F2NO+ |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (3S)-1-[(2,5-difluorophenyl)methyl]piperidin-1-ium-3-ol |
| SMILES | O[C@H]1CCC[NH+](Cc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C12H15F2NO/c13-10-3-4-12(14)9(6-10)7-15-5-1-2-11(16)8-15/h3-4,6,11,16H,1-2,5,7-8H2/p+1/t11-/m0/s1 |
| InChIKey | YLEUZEWMUUALQH-NSHDSACASA-O |
| XLogP | 0.50 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |