C14H16F2O — CID 107383366
3-[(2,5-difluorophenyl)methyl]cyclohept-2-en-1-ol (PubChem CID 107383366) has the molecular formula C14H16F2O and a molecular weight of 238.28 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methyl]cyclohept-2-en-1-ol.
| Compound Name | 3-[(2,5-difluorophenyl)methyl]cyclohept-2-en-1-ol |
|---|---|
| PubChem CID | 107383366 |
| Molecular Formula | C14H16F2O |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methyl]cyclohept-2-en-1-ol |
| SMILES | OC1C=C(Cc2cc(F)ccc2F)CCCC1 |
| InChI | InChI=1S/C14H16F2O/c15-12-5-6-14(16)11(9-12)7-10-3-1-2-4-13(17)8-10/h5-6,8-9,13,17H,1-4,7H2 |
| InChIKey | OFLIDAIRCHOJHK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|