C14H18O — CID 65172216
3-[(2-methylphenyl)methyl]cyclohex-2-en-1-ol (PubChem CID 65172216) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-[(2-methylphenyl)methyl]cyclohex-2-en-1-ol.
| Compound Name | 3-[(2-methylphenyl)methyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 65172216 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3-[(2-methylphenyl)methyl]cyclohex-2-en-1-ol |
| SMILES | Cc1ccccc1CC1=CC(O)CCC1 |
| InChI | InChI=1S/C14H18O/c1-11-5-2-3-7-13(11)9-12-6-4-8-14(15)10-12/h2-3,5,7,10,14-15H,4,6,8-9H2,1H3 |
| InChIKey | KWVOUFYNIOATKJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|