C12H12F2O — CID 65174539
3-[(2,3-difluorophenyl)methyl]cyclopent-2-en-1-ol (PubChem CID 65174539) has the molecular formula C12H12F2O and a molecular weight of 210.22 g/mol. Its IUPAC name is 3-[(2,3-difluorophenyl)methyl]cyclopent-2-en-1-ol.
| Compound Name | 3-[(2,3-difluorophenyl)methyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 65174539 |
| Molecular Formula | C12H12F2O |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-[(2,3-difluorophenyl)methyl]cyclopent-2-en-1-ol |
| SMILES | OC1C=C(Cc2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C12H12F2O/c13-11-3-1-2-9(12(11)14)6-8-4-5-10(15)7-8/h1-3,7,10,15H,4-6H2 |
| InChIKey | KLYCFILWHVQWIL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|