C19H23F2NO3 — CID 171970482
tert-butyl 7-[(2,3-difluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171970482) has the molecular formula C19H23F2NO3 and a molecular weight of 351.39 g/mol. Its IUPAC name is tert-butyl 7-[(2,3-difluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | tert-butyl 7-[(2,3-difluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171970482 |
| Molecular Formula | C19H23F2NO3 |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | tert-butyl 7-[(2,3-difluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(Cc3cccc(F)c3F)CC1COC2 |
| InChI | InChI=1S/C19H23F2NO3/c1-19(2,3)25-18(23)22-14-8-12(9-15(22)11-24-10-14)7-13-5-4-6-16(20)17(13)21/h4-6,8,14-15H,7,9-11H2,1-3H3 |
| InChIKey | STKBBCYFNCTARL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|