C22H31NO5 — CID 171968527
tert-butyl 7-[2-(2-ethoxyphenoxy)ethyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171968527) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is tert-butyl 7-[2-(2-ethoxyphenoxy)ethyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | tert-butyl 7-[2-(2-ethoxyphenoxy)ethyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171968527 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | tert-butyl 7-[2-(2-ethoxyphenoxy)ethyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | CCOc1ccccc1OCCC1=CC2COCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31NO5/c1-5-26-19-8-6-7-9-20(19)27-11-10-16-12-17-14-25-15-18(13-16)23(17)21(24)28-22(2,3)4/h6-9,12,17-18H,5,10-11,13-15H2,1-4H3 |
| InChIKey | OHIJPCTXIWABIK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|