C18H32N2O2+2 — CID 4741512
1-[(2,5-dimethoxyphenyl)methyl]-4-pentan-3-ylpiperazine-1,4-diium (PubChem CID 4741512) has the molecular formula C18H32N2O2+2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)methyl]-4-pentan-3-ylpiperazine-1,4-diium.
| Compound Name | 1-[(2,5-dimethoxyphenyl)methyl]-4-pentan-3-ylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 4741512 |
| Molecular Formula | C18H32N2O2+2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)methyl]-4-pentan-3-ylpiperazine-1,4-diium |
| SMILES | CCC(CC)[NH+]1CC[NH+](Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C18H30N2O2/c1-5-16(6-2)20-11-9-19(10-12-20)14-15-13-17(21-3)7-8-18(15)22-4/h7-8,13,16H,5-6,9-12,14H2,1-4H3/p+2 |
| InChIKey | MRYAFXGLZPERJL-UHFFFAOYSA-P |
| XLogP | 0.18 |
| TPSA | 27.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |