C18H21ClNO2+ — CID 7439336
(3S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]piperidin-1-ium-3-ol (PubChem CID 7439336) has the molecular formula C18H21ClNO2+ and a molecular weight of 318.82 g/mol. Its IUPAC name is (3S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]piperidin-1-ium-3-ol.
| Compound Name | (3S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]piperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 7439336 |
| Molecular Formula | C18H21ClNO2+ |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (3S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]piperidin-1-ium-3-ol |
| SMILES | O[C@H]1CCC[NH+](Cc2cccc(Oc3ccc(Cl)cc3)c2)C1 |
| InChI | InChI=1S/C18H20ClNO2/c19-15-6-8-17(9-7-15)22-18-5-1-3-14(11-18)12-20-10-2-4-16(21)13-20/h1,3,5-9,11,16,21H,2,4,10,12-13H2/p+1/t16-/m0/s1 |
| InChIKey | DLJIWGXIMPFJLY-INIZCTEOSA-O |
| XLogP | 2.67 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |