C20H25ClNO+ — CID 7444215
(2S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]-2-ethylpiperidin-1-ium (PubChem CID 7444215) has the molecular formula C20H25ClNO+ and a molecular weight of 330.88 g/mol. Its IUPAC name is (2S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]-2-ethylpiperidin-1-ium.
| Compound Name | (2S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]-2-ethylpiperidin-1-ium |
|---|---|
| PubChem CID | 7444215 |
| Molecular Formula | C20H25ClNO+ |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (2S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]-2-ethylpiperidin-1-ium |
| SMILES | CC[C@H]1CCCC[NH+]1Cc1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H24ClNO/c1-2-18-7-3-4-13-22(18)15-16-6-5-8-20(14-16)23-19-11-9-17(21)10-12-19/h5-6,8-12,14,18H,2-4,7,13,15H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | ULROMQJNQYTWLK-SFHVURJKSA-O |
| XLogP | 4.48 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |