C20H26NO+ — CID 6983219
(2S)-2-ethyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium (PubChem CID 6983219) has the molecular formula C20H26NO+ and a molecular weight of 296.43 g/mol. Its IUPAC name is (2S)-2-ethyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium.
| Compound Name | (2S)-2-ethyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 6983219 |
| Molecular Formula | C20H26NO+ |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (2S)-2-ethyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium |
| SMILES | CC[C@H]1CCCC[NH+]1Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H25NO/c1-2-18-10-6-7-14-21(18)16-17-9-8-13-20(15-17)22-19-11-4-3-5-12-19/h3-5,8-9,11-13,15,18H,2,6-7,10,14,16H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | LKYKKYHKDXTEJF-SFHVURJKSA-O |
| XLogP | 3.83 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |