C19H19N2O3PS — CID 70424622
[4-(1,3-benzothiazol-2-yl)-2-oxopiperidin-1-yl]-benzylphosphinic acid (PubChem CID 70424622) has the molecular formula C19H19N2O3PS and a molecular weight of 386.41 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)-2-oxopiperidin-1-yl]-benzylphosphinic acid.
| Compound Name | [4-(1,3-benzothiazol-2-yl)-2-oxopiperidin-1-yl]-benzylphosphinic acid |
|---|---|
| PubChem CID | 70424622 |
| Molecular Formula | C19H19N2O3PS |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)-2-oxopiperidin-1-yl]-benzylphosphinic acid |
| SMILES | O=C1CC(c2nc3ccccc3s2)CCN1P(=O)(O)Cc1ccccc1 |
| InChI | InChI=1S/C19H19N2O3PS/c22-18-12-15(19-20-16-8-4-5-9-17(16)26-19)10-11-21(18)25(23,24)13-14-6-2-1-3-7-14/h1-9,15H,10-13H2,(H,23,24) |
| InChIKey | JWTRCQMPYULFIP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|