C12H15N3S — CID 66005217
N-[(3-aminocyclobutyl)methyl]-1,3-benzothiazol-2-amine (PubChem CID 66005217) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-[(3-aminocyclobutyl)methyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(3-aminocyclobutyl)methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 66005217 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-[(3-aminocyclobutyl)methyl]-1,3-benzothiazol-2-amine |
| SMILES | NC1CC(CNc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C12H15N3S/c13-9-5-8(6-9)7-14-12-15-10-3-1-2-4-11(10)16-12/h1-4,8-9H,5-7,13H2,(H,14,15) |
| InChIKey | HEZJPBLGANTKID-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |