C16H19N5S — CID 95326395
N-[[(6S)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]-1,3-benzothiazol-2-amine (PubChem CID 95326395) has the molecular formula C16H19N5S and a molecular weight of 313.43 g/mol. Its IUPAC name is N-[[(6S)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[[(6S)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 95326395 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[[(6S)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]-1,3-benzothiazol-2-amine |
| SMILES | CCc1nnc2n1C[C@H](CNc1nc3ccccc3s1)CC2 |
| InChI | InChI=1S/C16H19N5S/c1-2-14-19-20-15-8-7-11(10-21(14)15)9-17-16-18-12-5-3-4-6-13(12)22-16/h3-6,11H,2,7-10H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | CGHLEHDYICPOFU-NSHDSACASA-N |
| XLogP | 3.12 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |