C17H20N6 — CID 95764258
N-[[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]quinazolin-4-amine (PubChem CID 95764258) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is N-[[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]quinazolin-4-amine.
| Compound Name | N-[[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 95764258 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-[[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]quinazolin-4-amine |
| SMILES | CCc1nnc2n1C[C@@H](CNc1ncnc3ccccc13)CC2 |
| InChI | InChI=1S/C17H20N6/c1-2-15-21-22-16-8-7-12(10-23(15)16)9-18-17-13-5-3-4-6-14(13)19-11-20-17/h3-6,11-12H,2,7-10H2,1H3,(H,18,19,20)/t12-/m1/s1 |
| InChIKey | JNUAYQGWMIQDKN-GFCCVEGCSA-N |
| XLogP | 2.46 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |