C14H17N7 — CID 95321392
N-[[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 95321392) has the molecular formula C14H17N7 and a molecular weight of 283.34 g/mol. Its IUPAC name is N-[[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 95321392 |
| Molecular Formula | C14H17N7 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-[[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nnc2n1C[C@H](CNc1ncnc3[nH]ccc13)CC2 |
| InChI | InChI=1S/C14H17N7/c1-9-19-20-12-3-2-10(7-21(9)12)6-16-14-11-4-5-15-13(11)17-8-18-14/h4-5,8,10H,2-3,6-7H2,1H3,(H2,15,16,17,18)/t10-/m0/s1 |
| InChIKey | NOPUIKBOJGICHA-JTQLQIEISA-N |
| XLogP | 1.53 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |