C14H14N6 — CID 95290576
N-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]quinazolin-4-amine (PubChem CID 95290576) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is N-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]quinazolin-4-amine.
| Compound Name | N-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 95290576 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]quinazolin-4-amine |
| SMILES | c1ccc2c(N[C@@H]3CCc4ncnn4C3)ncnc2c1 |
| InChI | InChI=1S/C14H14N6/c1-2-4-12-11(3-1)14(17-8-15-12)19-10-5-6-13-16-9-18-20(13)7-10/h1-4,8-10H,5-7H2,(H,15,17,19)/t10-/m1/s1 |
| InChIKey | XKMJNDNRQQMRRO-SNVBAGLBSA-N |
| XLogP | 1.65 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |