C17H18N6 — CID 95599795
N-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]quinazolin-4-amine (PubChem CID 95599795) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]quinazolin-4-amine.
| Compound Name | N-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 95599795 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]quinazolin-4-amine |
| SMILES | c1cnnc(N2CCC[C@@H](Nc3ncnc4ccccc34)C2)c1 |
| InChI | InChI=1S/C17H18N6/c1-2-7-15-14(6-1)17(19-12-18-15)21-13-5-4-10-23(11-13)16-8-3-9-20-22-16/h1-3,6-9,12-13H,4-5,10-11H2,(H,18,19,21)/t13-/m1/s1 |
| InChIKey | JKJPXKQOSBYNKH-CYBMUJFWSA-N |
| XLogP | 2.50 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |