C19H18N6S — CID 133281591
2-methyl-5-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 133281591) has the molecular formula C19H18N6S and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-methyl-5-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-methyl-5-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133281591 |
| Molecular Formula | C19H18N6S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-methyl-5-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(NC2CCc3ncnn3C2)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C19H18N6S/c1-12-22-18(24-14-7-8-16-20-11-21-25(16)9-14)17-15(10-26-19(17)23-12)13-5-3-2-4-6-13/h2-6,10-11,14H,7-9H2,1H3,(H,22,23,24) |
| InChIKey | JJHQTVGWMVTRRX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |