C23H24N4O2S — CID 133417765
1-[4-[(2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]pyrrolidine-2,5-dione (PubChem CID 133417765) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is 1-[4-[(2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[(2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 133417765 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 1-[4-[(2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]pyrrolidine-2,5-dione |
| SMILES | Cc1nc(NC2CCC(N3C(=O)CCC3=O)CC2)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C23H24N4O2S/c1-14-24-22(21-18(13-30-23(21)25-14)15-5-3-2-4-6-15)26-16-7-9-17(10-8-16)27-19(28)11-12-20(27)29/h2-6,13,16-17H,7-12H2,1H3,(H,24,25,26) |
| InChIKey | NQDYPFGLJJUGIJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|