C24H24N4S — CID 985393
N-(1-benzylpiperidin-4-yl)-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 985393) has the molecular formula C24H24N4S and a molecular weight of 400.55 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 985393 |
| Molecular Formula | C24H24N4S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc(CN2CCC(Nc3ncnc4scc(-c5ccccc5)c34)CC2)cc1 |
| InChI | InChI=1S/C24H24N4S/c1-3-7-18(8-4-1)15-28-13-11-20(12-14-28)27-23-22-21(19-9-5-2-6-10-19)16-29-24(22)26-17-25-23/h1-10,16-17,20H,11-15H2,(H,25,26,27) |
| InChIKey | UUVLNXOVNYNPAB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |