C14H19N3S — CID 80553613
N-(1,3-benzothiazol-2-ylmethyl)-1-piperidin-3-ylmethanamine (PubChem CID 80553613) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-1-piperidin-3-ylmethanamine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-1-piperidin-3-ylmethanamine |
|---|---|
| PubChem CID | 80553613 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-1-piperidin-3-ylmethanamine |
| SMILES | c1ccc2sc(CNCC3CCCNC3)nc2c1 |
| InChI | InChI=1S/C14H19N3S/c1-2-6-13-12(5-1)17-14(18-13)10-16-9-11-4-3-7-15-8-11/h1-2,5-6,11,15-16H,3-4,7-10H2 |
| InChIKey | RTRZYDCDKRHUCJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |