C20H21N3OS — CID 119268823
N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]piperidine-3-carboxamide (PubChem CID 119268823) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]piperidine-3-carboxamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119268823 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cc2nc3ccccc3s2)cc1)C1CCCNC1 |
| InChI | InChI=1S/C20H21N3OS/c24-20(15-4-3-11-21-13-15)22-16-9-7-14(8-10-16)12-19-23-17-5-1-2-6-18(17)25-19/h1-2,5-10,15,21H,3-4,11-13H2,(H,22,24) |
| InChIKey | XTUAUHOPDPMMPF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |