C21H22N4O2S — CID 34548052
(3S)-3-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]piperidine-1,3-dicarboxamide (PubChem CID 34548052) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is (3S)-3-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 34548052 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (3S)-3-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCC[C@H](C(=O)Nc2ccc(Cc3nc4ccccc4s3)cc2)C1 |
| InChI | InChI=1S/C21H22N4O2S/c22-21(27)25-11-3-4-15(13-25)20(26)23-16-9-7-14(8-10-16)12-19-24-17-5-1-2-6-18(17)28-19/h1-2,5-10,15H,3-4,11-13H2,(H2,22,27)(H,23,26)/t15-/m0/s1 |
| InChIKey | NEBLVFYLZVDDAX-HNNXBMFYSA-N |
| XLogP | 3.62 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |