C24H28N4O2S — CID 166232539
N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-2-oxo-2-[3-(propan-2-ylamino)piperidin-1-yl]acetamide (PubChem CID 166232539) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-2-oxo-2-[3-(propan-2-ylamino)piperidin-1-yl]acetamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-2-oxo-2-[3-(propan-2-ylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 166232539 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-2-oxo-2-[3-(propan-2-ylamino)piperidin-1-yl]acetamide |
| SMILES | CC(C)NC1CCCN(C(=O)C(=O)Nc2ccc(Cc3nc4ccccc4s3)cc2)C1 |
| InChI | InChI=1S/C24H28N4O2S/c1-16(2)25-19-6-5-13-28(15-19)24(30)23(29)26-18-11-9-17(10-12-18)14-22-27-20-7-3-4-8-21(20)31-22/h3-4,7-12,16,19,25H,5-6,13-15H2,1-2H3,(H,26,29) |
| InChIKey | HAWKDORNOQFDTC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|