C14H16N2O3S2 — CID 146509399
4-(1,3-benzothiazol-2-ylsulfonylmethyl)-1-methylpiperidin-2-one (PubChem CID 146509399) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfonylmethyl)-1-methylpiperidin-2-one.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfonylmethyl)-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 146509399 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfonylmethyl)-1-methylpiperidin-2-one |
| SMILES | CN1CCC(CS(=O)(=O)c2nc3ccccc3s2)CC1=O |
| InChI | InChI=1S/C14H16N2O3S2/c1-16-7-6-10(8-13(16)17)9-21(18,19)14-15-11-4-2-3-5-12(11)20-14/h2-5,10H,6-9H2,1H3 |
| InChIKey | MIEDHSICSLPARJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |