C19H19NOS — CID 163319839
2-[(2R)-2-(phenylmethoxymethyl)but-3-enyl]-1,3-benzothiazole (PubChem CID 163319839) has the molecular formula C19H19NOS and a molecular weight of 309.43 g/mol. Its IUPAC name is 2-[(2R)-2-(phenylmethoxymethyl)but-3-enyl]-1,3-benzothiazole.
| Compound Name | 2-[(2R)-2-(phenylmethoxymethyl)but-3-enyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 163319839 |
| Molecular Formula | C19H19NOS |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-[(2R)-2-(phenylmethoxymethyl)but-3-enyl]-1,3-benzothiazole |
| SMILES | C=C[C@H](COCc1ccccc1)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H19NOS/c1-2-15(13-21-14-16-8-4-3-5-9-16)12-19-20-17-10-6-7-11-18(17)22-19/h2-11,15H,1,12-14H2/t15-/m0/s1 |
| InChIKey | ATRXKCJNBKYBMF-HNNXBMFYSA-N |
| XLogP | 4.86 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|